WikipediaCAS 53306-54-0
Live English Wikipedia chembox and article.
Wikipedia chembox
| Names | |
|---|---|
| Preferred IUPAC name | Bis(2-propylheptyl) benzene-1,2-dicarboxylate |
| Other names | Bis(2-propylheptyl) phthalate |
| Identifiers | |
| CAS Number | 53306-54-0 |
| ChemSpider | 83367 |
| EC Number | 258-469-4 |
| PubChem CID | 92344 |
| InChI | InChI=1S/C28H46O4/c1-5-9-11-17-23(15-7-3)21-31-27(29)25-19-13-14-20-26(25)28(30)32-22-24(16-8-4)18-12-10-6-2/h13-14,19-20,23-24H,5-12,15-18,21-22H2,1-4H3 · Key: MTYUOIVEVPTXFX-UHFFFAOYSA-N |
| SMILES | CCCCCC(CCC)COC(=O)c1ccccc1C(=O)OCC(CCC)CCCCC |
| Properties | |
| Chemical formula | C 28 H 46 O 4 |
| Molar mass | 446.672 g · mol−1 |
| Appearance | Clear oily liquid |
| Density | 0.957-0.965 g/cm3 |
| Solubility in water | < 0.01 mg/L |
| Refractive index ( n D) | 1.482-1.484 |
| Viscosity | 120-130 mPas |
| standard state | Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). · Infobox references |
Wikipedia
Chemical compound
Di(2-propylheptyl) phthalate (also known as bis(2-propylheptyl) benzene-1,2-dicarboxylate, di(propylheptyl) orthophthalate, or DPHP) is an organic compound with the formula C28H46O4. It is a phthalate and is the diester of phthalic acid and the 10-carbon branched-chain alcohol 2-propylheptanol. This colorless, viscous liquid is used for softening PVC plastics and is a general purpose PVC plasticizer. It possesses very good plasticizing properties and may be used as a direct replacement for DEHP and DINP in many applications.